CAS:79128-08-8|1,3-Diisopropoxybenzene
Molecular Formula:C12H18O2
Molecular Weight:194.27g/mol
Purity:98 percent
Package:5g/10g/25g/50g/bulk package
- Достава широм света
- Доказ о квалитету
- 24/7 корисничка служба
Представљање производа
1,3-Diisopropoxybenzene(CAS:79128-08-8) has been used in a variety of scientific research applications. It has been used as a solvent in the synthesis of polymers, as a reagent in organic synthesis, and in the production of other organic compounds. Additionally, DIPB has been used as a starting material in the synthesis of various pharmaceuticals, such as antibiotics and anti-cancer drugs.
|
|
|
| 1,3-di(propan-2-yloxy)benzene | |
| MFCD07784412 | |
| 89.5 - 95 degree at 3 mmHg | |
| 110ºC | |
| 0.964 g/mL at 25 degree | |
| 18.46 | |
| 3.26 | |
| 1.495 | |
| InChI=1S/C12H18O2/c1-9(2)13-11-6-5-7-12(8-11)14-10(3)4/h5-10H,1-4H3 | |
| REKFSOLBSHAFDG-UHFFFAOYSA-N |
Popularne oznake: cas:79128-08-8|1,3-diisopropoxybenzene, price, quotation, discount, in stock, for sale
